CAS 22201-45-2 appears in our catalog under these names: 4-tert-Butylbenzoic anhydride, 95%, 4-tert-Butylbenzoic anhydride, 95% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g.
(4-tert-butylbenzoyl) 4-tert-butylbenzoate (CAS 22201-45-2) is a chemical compound with the molecular formula C22H26O3 and a molecular weight of 338.4 g/mol. IUPAC name: (4-tert-butylbenzoyl) 4-tert-butylbenzoate. InChIKey: KKDPRVYYZZUPLR-UHFFFAOYSA-N.
| Molecular formula | C22H26O3 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | (4-tert-butylbenzoyl) 4-tert-butylbenzoate |
| InChIKey | KKDPRVYYZZUPLR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)OC(=O)C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)