CAS 2911-81-1 appears in our catalog under these names: Levonorgestrel Impurity 10, 13-Ethyl-3-methoxygona-1,3,5(10)-8,14-pentaen-17beta-ol-acetate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
[(13S,17S)-13-ethyl-3-methoxy-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate (CAS 2911-81-1) is a chemical compound with the molecular formula C22H26O3 and a molecular weight of 338.4 g/mol. IUPAC name: [(13S,17S)-13-ethyl-3-methoxy-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate. InChIKey: PPOUPUKRVJUOAF-VXKWHMMOSA-N.
| Molecular formula | C22H26O3 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | [(13S,17S)-13-ethyl-3-methoxy-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate |
| InChIKey | PPOUPUKRVJUOAF-VXKWHMMOSA-N |
| SMILES | CC[C@]12CCC3=C(C1=CC[C@@H]2OC(=O)C)CCC4=C3C=CC(=C4)OC |
Computed by PubChem (NCBI)