CAS 22202-68-2 appears in our catalog under these names: 2-Ketoglutaric acid Sodium/ 100%, 2-Ketoglutaric acid (Sodium), 98.0%, 2-Ketoglutaric acid (Sodium) (Standard), 2-Ketoglutaric acid (Sodium) (GMP), Alpha-ketoglutaric acid sodium salt, 95%. Offered by: TargetMol, MedChemExpress, Combi-blocks, TRC, GLPBio. Available pack sizes: 250mg, 100 mg, 10mM/1mL, 50 mg, 250 mg, 25 mg, Get quote, 100g.
Disodium;2-oxopentanedioate (CAS 22202-68-2) is a chemical compound with the molecular formula C5H4Na2O5 and a molecular weight of 190.06 g/mol. IUPAC name: disodium;2-oxopentanedioate. InChIKey: YBGBJYVHJTVUSL-UHFFFAOYSA-L.
| Molecular formula | C5H4Na2O5 |
|---|---|
| Molecular weight | 190.06 g/mol |
| IUPAC name | disodium;2-oxopentanedioate |
| InChIKey | YBGBJYVHJTVUSL-UHFFFAOYSA-L |
| SMILES | C(CC(=O)[O-])C(=O)C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)