CAS 305-72-6 appears in our catalog under these names: Alpha-ketoglutaric acid disodium salt dihydrate, 98%, Sodium 2-oxopentanedioate, 98%, Disodium 2–Oxoglutarate, ^a-Ketoglutaric acid disodium , 2-Ketoglutaric acid, disodium salt, dihydrate, 99%. Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros). Available pack sizes: 25g, 100g, 1g, 5g, 250g, 50g, 500g.
Disodium;2-oxopentanedioate (CAS 305-72-6) is a chemical compound with the molecular formula C5H4Na2O5 and a molecular weight of 190.06 g/mol. IUPAC name: disodium;2-oxopentanedioate. InChIKey: YBGBJYVHJTVUSL-UHFFFAOYSA-L.
| Molecular formula | C5H4Na2O5 |
|---|---|
| Molecular weight | 190.06 g/mol |
| IUPAC name | disodium;2-oxopentanedioate |
| InChIKey | YBGBJYVHJTVUSL-UHFFFAOYSA-L |
| SMILES | C(CC(=O)[O-])C(=O)C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)