CAS 22219-00-7 appears in our catalog under these names: 2,2'-Dicarboxydiphenylsulphone, 95%, 2,2'-Dicarboxydiphenylsulphone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 500mg.
2-(2-carboxyphenyl)sulfonylbenzoic acid (CAS 22219-00-7) is a chemical compound with the molecular formula C14H10O6S and a molecular weight of 306.29 g/mol. IUPAC name: 2-(2-carboxyphenyl)sulfonylbenzoic acid. InChIKey: AOFRNZNXMCOXHP-UHFFFAOYSA-N.
| Molecular formula | C14H10O6S |
|---|---|
| Molecular weight | 306.29 g/mol |
| IUPAC name | 2-(2-carboxyphenyl)sulfonylbenzoic acid |
| InChIKey | AOFRNZNXMCOXHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)S(=O)(=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)