CAS 2449-35-6 appears in our catalog under these names: 4,4'–Sulfonyldibenzoic Acid, 4,4'-Dicarboxydiphenyl Sulfone, >98.0%(HPLC), 4,4'-Sulfonyldibenzoic acid 98%, 4,4'-Sulfonyldibenzoic Acid, 98%, 98%, 4,4'-Sulfonyldibenzoic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100g, 10g.
4-(4-carboxyphenyl)sulfonylbenzoic acid (CAS 2449-35-6) is a chemical compound with the molecular formula C14H10O6S and a molecular weight of 306.29 g/mol. IUPAC name: 4-(4-carboxyphenyl)sulfonylbenzoic acid. InChIKey: SQJQLYOMPSJVQS-UHFFFAOYSA-N.
| Molecular formula | C14H10O6S |
|---|---|
| Molecular weight | 306.29 g/mol |
| IUPAC name | 4-(4-carboxyphenyl)sulfonylbenzoic acid |
| InChIKey | SQJQLYOMPSJVQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)S(=O)(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)