Products 2222042-47-7
CAS 2222042-47-7 is the registry number for As-358. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3-piperidin-1-ylpropanoate (CAS 2222042-47-7) is a chemical compound with the molecular formula C18H31NO2 and a molecular weight of 293.4 g/mol. IUPAC name: [(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3-piperidin-1-ylpropanoate. InChIKey: BMTQTMGZNRLSQL-HDMKZQKVSA-N.
| Molecular formula | C18H31NO2 |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | [(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3-piperidin-1-ylpropanoate |
| InChIKey | BMTQTMGZNRLSQL-HDMKZQKVSA-N |
| SMILES | C[C@]12CC[C@H](C1(C)C)C[C@H]2OC(=O)CCN3CCCCC3 |
Computed by PubChem (NCBI)