CAS 745767-97-9 appears in our catalog under these names: Fingolimod EP Impurity B , Fingolimod Impurity 7, Fingolimod Impurity 6, 2-Amino-2-(2-(4-heptylphenyl)ethyl)propane-1,3-diol, >95% (HPLC), 2-Amino-2-[2-(4-heptylphenyl)ethyl]-1,3-propanediol, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
2-amino-2-[2-(4-heptylphenyl)ethyl]propane-1,3-diol (CAS 745767-97-9) is a chemical compound with the molecular formula C18H31NO2 and a molecular weight of 293.4 g/mol. IUPAC name: 2-amino-2-[2-(4-heptylphenyl)ethyl]propane-1,3-diol. InChIKey: ZCQGLIFMOHCDGN-UHFFFAOYSA-N.
| Molecular formula | C18H31NO2 |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 2-amino-2-[2-(4-heptylphenyl)ethyl]propane-1,3-diol |
| InChIKey | ZCQGLIFMOHCDGN-UHFFFAOYSA-N |
| SMILES | CCCCCCCC1=CC=C(C=C1)CCC(CO)(CO)N |
Computed by PubChem (NCBI)