Products 2222846-05-9
CAS 2222846-05-9 is the registry number for (R)-1-(1H-Indazol-4-yl)propan-2-amine dihydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
(2R)-1-(1H-indazol-4-yl)propan-2-amine;hydrochloride (CAS 2222846-05-9) is a chemical compound with the molecular formula C10H14ClN3 and a molecular weight of 211.69 g/mol. IUPAC name: (2R)-1-(1H-indazol-4-yl)propan-2-amine;hydrochloride. InChIKey: QFGISZIPGCCTQK-OGFXRTJISA-N.
| Molecular formula | C10H14ClN3 |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | (2R)-1-(1H-indazol-4-yl)propan-2-amine;hydrochloride |
| InChIKey | QFGISZIPGCCTQK-OGFXRTJISA-N |
| SMILES | C[C@H](CC1=C2C=NNC2=CC=C1)N.Cl |
Computed by PubChem (NCBI)