Products 2222997-32-0
CAS 2222997-32-0 is the registry number for 3-Methyl-1-(tetrahydrofuran-3-yl)pyrazole-4-boronic Acid Pinacol Ester, >95%. Offered by: Chemat. Available pack sizes: 100mg.
3-methyl-1-(oxolan-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2222997-32-0) is a chemical compound with the molecular formula C14H23BN2O3 and a molecular weight of 278.16 g/mol. IUPAC name: 3-methyl-1-(oxolan-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: GZEIRMPGKUIFGG-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O3 |
|---|---|
| Molecular weight | 278.16 g/mol |
| IUPAC name | 3-methyl-1-(oxolan-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | GZEIRMPGKUIFGG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2C)C3CCOC3 |
Computed by PubChem (NCBI)