CAS 2223030-87-1 is the registry number for 4,4,5,5–tetramethyl–2–(4–propylfuran–2–yl)–1,3,2–dioxaborolane. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
4,4,5,5-tetramethyl-2-(4-propylfuran-2-yl)-1,3,2-dioxaborolane (CAS 2223030-87-1) is a chemical compound with the molecular formula C13H21BO3 and a molecular weight of 236.12 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-propylfuran-2-yl)-1,3,2-dioxaborolane. InChIKey: FTBAEZUOCMHVHY-UHFFFAOYSA-N.
| Molecular formula | C13H21BO3 |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-propylfuran-2-yl)-1,3,2-dioxaborolane |
| InChIKey | FTBAEZUOCMHVHY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CO2)CCC |
Computed by PubChem (NCBI)