CAS 2761985-36-6 is the registry number for 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)bicyclo[4.1.0]heptan-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)bicyclo[4.1.0]heptan-3-one (CAS 2761985-36-6) is a chemical compound with the molecular formula C13H21BO3 and a molecular weight of 236.12 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)bicyclo[4.1.0]heptan-3-one. InChIKey: FKFIWADWYFGFRV-UHFFFAOYSA-N.
| Molecular formula | C13H21BO3 |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)bicyclo[4.1.0]heptan-3-one |
| InChIKey | FKFIWADWYFGFRV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C23CCC(=O)CC2C3 |
Computed by PubChem (NCBI)