CAS 2223035-77-4 appears in our catalog under these names: 2-Ethoxypyrimidin-5-ylboronic acid pinacol ester, 95%, 2-Ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 95+%, 2-Ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg.
2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 2223035-77-4) is a chemical compound with the molecular formula C12H19BN2O3 and a molecular weight of 250.10 g/mol. IUPAC name: 2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: LRZCARRDCNWOIO-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O3 |
|---|---|
| Molecular weight | 250.10 g/mol |
| IUPAC name | 2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | LRZCARRDCNWOIO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)OCC |
Computed by PubChem (NCBI)