Products 2750602-18-5
CAS 2750602-18-5 is the registry number for 4-Methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 2750602-18-5) is a chemical compound with the molecular formula C12H19BN2O3 and a molecular weight of 250.10 g/mol. IUPAC name: 4-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: DFYXOPUKVITYML-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O3 |
|---|---|
| Molecular weight | 250.10 g/mol |
| IUPAC name | 4-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | DFYXOPUKVITYML-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CN=C2OC)C |
Computed by PubChem (NCBI)