Products 2223043-30-7
CAS 2223043-30-7 is the registry number for 6-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinonitrile, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile (CAS 2223043-30-7) is a chemical compound with the molecular formula C13H17BN2O3 and a molecular weight of 260.10 g/mol. IUPAC name: 6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile. InChIKey: MORBTKNFRODXNX-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O3 |
|---|---|
| Molecular weight | 260.10 g/mol |
| IUPAC name | 6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile |
| InChIKey | MORBTKNFRODXNX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)OC)C#N |
Computed by PubChem (NCBI)