CAS 2223053-20-9 is the registry number for 2-Bromo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine (CAS 2223053-20-9) is a chemical compound with the molecular formula C10H14BBrN2O2 and a molecular weight of 284.95 g/mol. IUPAC name: 2-bromo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine. InChIKey: QNJHXIUMNLKPAI-UHFFFAOYSA-N.
| Molecular formula | C10H14BBrN2O2 |
|---|---|
| Molecular weight | 284.95 g/mol |
| IUPAC name | 2-bromo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine |
| InChIKey | QNJHXIUMNLKPAI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CC(=N2)Br |
Computed by PubChem (NCBI)