Products 2225173-66-8
CAS 2225173-66-8 is the registry number for 5–Bromo–6–(piperidin–1–yl)pyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
(5-bromo-6-piperidin-1-yl-3-pyridinyl)boronic acid (CAS 2225173-66-8) is a chemical compound with the molecular formula C10H14BBrN2O2 and a molecular weight of 284.95 g/mol. IUPAC name: (5-bromo-6-piperidin-1-yl-3-pyridinyl)boronic acid. InChIKey: WZUSKLKTBANWCH-UHFFFAOYSA-N.
| Molecular formula | C10H14BBrN2O2 |
|---|---|
| Molecular weight | 284.95 g/mol |
| IUPAC name | (5-bromo-6-piperidin-1-yl-3-pyridinyl)boronic acid |
| InChIKey | WZUSKLKTBANWCH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)N2CCCCC2)Br)(O)O |
Computed by PubChem (NCBI)