CAS 2225137-21-1 is the registry number for Lithium 2-(5-methylpyrazin-2-yl)acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Lithium 2-(5-methylpyrazin-2-yl)acetate (CAS 2225137-21-1) is a chemical compound with the molecular formula C7H7LiN2O2 and a molecular weight of 158.1 g/mol. IUPAC name: lithium 2-(5-methylpyrazin-2-yl)acetate. InChIKey: YUPKAFJZIQEBPH-UHFFFAOYSA-M.
| Molecular formula | C7H7LiN2O2 |
|---|---|
| Molecular weight | 158.1 g/mol |
| IUPAC name | lithium 2-(5-methylpyrazin-2-yl)acetate |
| InChIKey | YUPKAFJZIQEBPH-UHFFFAOYSA-M |
| SMILES | [Li+].CC1=CN=C(C=N1)CC(=O)[O-] |
Computed by PubChem (NCBI)