CAS 2243507-17-5 is the registry number for 5H,6H,7H-pyrrolo(1,2-c)imidazole-3-carboxylate lithium. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Lithium 6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-carboxylate (CAS 2243507-17-5) is a chemical compound with the molecular formula C7H7LiN2O2 and a molecular weight of 158.1 g/mol. IUPAC name: lithium 6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-carboxylate. InChIKey: KUVXKTDYINLLSA-UHFFFAOYSA-M.
| Molecular formula | C7H7LiN2O2 |
|---|---|
| Molecular weight | 158.1 g/mol |
| IUPAC name | lithium 6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-carboxylate |
| InChIKey | KUVXKTDYINLLSA-UHFFFAOYSA-M |
| SMILES | [Li+].C1CC2=CN=C(N2C1)C(=O)[O-] |
Computed by PubChem (NCBI)