Products 2225142-21-0
CAS 2225142-21-0 is the registry number for 6-(Aminomethyl)spiro(3.5)nonan-5-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
8-(aminomethyl)spiro[3.5]nonan-9-ol;hydrochloride (CAS 2225142-21-0) is a chemical compound with the molecular formula C10H20ClNO and a molecular weight of 205.72 g/mol. IUPAC name: 8-(aminomethyl)spiro[3.5]nonan-9-ol;hydrochloride. InChIKey: UZGTZDAVLXLNGI-UHFFFAOYSA-N.
| Molecular formula | C10H20ClNO |
|---|---|
| Molecular weight | 205.72 g/mol |
| IUPAC name | 8-(aminomethyl)spiro[3.5]nonan-9-ol;hydrochloride |
| InChIKey | UZGTZDAVLXLNGI-UHFFFAOYSA-N |
| SMILES | C1CC(C(C2(C1)CCC2)O)CN.Cl |
Computed by PubChem (NCBI)