Products 2225144-87-4
CAS 2225144-87-4 is the registry number for tert-Butyl 4-amino-8,8-dioxo-8λ6-thia-2-azaspiro(4.5)decane-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 4-amino-8,8-dioxo-8lambda6-thia-2-azaspiro[4.5]decane-2-carboxylate (CAS 2225144-87-4) is a chemical compound with the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. IUPAC name: tert-butyl 4-amino-8,8-dioxo-8lambda6-thia-2-azaspiro[4.5]decane-2-carboxylate. InChIKey: QGLJPYRZXUVWTI-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O4S |
|---|---|
| Molecular weight | 304.41 g/mol |
| IUPAC name | tert-butyl 4-amino-8,8-dioxo-8lambda6-thia-2-azaspiro[4.5]decane-2-carboxylate |
| InChIKey | QGLJPYRZXUVWTI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C2(C1)CCS(=O)(=O)CC2)N |
Computed by PubChem (NCBI)