Products 2269513-46-2
CAS 2269513-46-2 is the registry number for tert-Butyl 7-(methylsulfonyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS 2269513-46-2) is a chemical compound with the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. IUPAC name: tert-butyl 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane-2-carboxylate. InChIKey: ASPAGTPXWBWQNY-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O4S |
|---|---|
| Molecular weight | 304.41 g/mol |
| IUPAC name | tert-butyl 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| InChIKey | ASPAGTPXWBWQNY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCN(CC2)S(=O)(=O)C |
Computed by PubChem (NCBI)