Products 2225146-93-8
CAS 2225146-93-8 is the registry number for 3,3-Difluoro-1-(pyridin-3-yl)cyclobutane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,3-difluoro-1-pyridin-3-ylcyclobutane-1-carboxylic acid;hydrochloride (CAS 2225146-93-8) is a chemical compound with the molecular formula C10H10ClF2NO2 and a molecular weight of 249.64 g/mol. IUPAC name: 3,3-difluoro-1-pyridin-3-ylcyclobutane-1-carboxylic acid;hydrochloride. InChIKey: IKGJVRNKPOQOGB-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF2NO2 |
|---|---|
| Molecular weight | 249.64 g/mol |
| IUPAC name | 3,3-difluoro-1-pyridin-3-ylcyclobutane-1-carboxylic acid;hydrochloride |
| InChIKey | IKGJVRNKPOQOGB-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)(C2=CN=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)