Products 958643-23-7
CAS 958643-23-7 is the registry number for 2-Chloro-2,2-difluoro-N-((4-methoxyphenyl)methyl)acetamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2-chloro-2,2-difluoro-N-[(4-methoxyphenyl)methyl]acetamide (CAS 958643-23-7) is a chemical compound with the molecular formula C10H10ClF2NO2 and a molecular weight of 249.64 g/mol. IUPAC name: 2-chloro-2,2-difluoro-N-[(4-methoxyphenyl)methyl]acetamide. InChIKey: GFVMGJAHCMKMAC-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF2NO2 |
|---|---|
| Molecular weight | 249.64 g/mol |
| IUPAC name | 2-chloro-2,2-difluoro-N-[(4-methoxyphenyl)methyl]acetamide |
| InChIKey | GFVMGJAHCMKMAC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC(=O)C(F)(F)Cl |
Computed by PubChem (NCBI)