CAS 2225152-69-0 is the registry number for 2–Cyano–6–(sec–butyl–d9)–pyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-cyano-6-(1,1,1,2,3,3,4,4,4-nonadeuteriobutan-2-yl)-4-pyridinyl]boronic acid (CAS 2225152-69-0) is a chemical compound with the molecular formula C10H13BN2O2 and a molecular weight of 213.09 g/mol. IUPAC name: [2-cyano-6-(1,1,1,2,3,3,4,4,4-nonadeuteriobutan-2-yl)-4-pyridinyl]boronic acid. InChIKey: JZOPBFFWNYNOCO-HNVRTPQGSA-N.
| Molecular formula | C10H13BN2O2 |
|---|---|
| Molecular weight | 213.09 g/mol |
| IUPAC name | [2-cyano-6-(1,1,1,2,3,3,4,4,4-nonadeuteriobutan-2-yl)-4-pyridinyl]boronic acid |
| InChIKey | JZOPBFFWNYNOCO-HNVRTPQGSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])(C1=CC(=CC(=N1)C#N)B(O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)