CAS 2640498-16-2 is the registry number for (3-Isopropyl-1H-pyrrolo[2,3-b]pyridin-5-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)boronic acid (CAS 2640498-16-2) is a chemical compound with the molecular formula C10H13BN2O2 and a molecular weight of 204.04 g/mol. IUPAC name: (3-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)boronic acid. InChIKey: KEKXHLCVGJGTIV-UHFFFAOYSA-N.
| Molecular formula | C10H13BN2O2 |
|---|---|
| Molecular weight | 204.04 g/mol |
| IUPAC name | (3-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)boronic acid |
| InChIKey | KEKXHLCVGJGTIV-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(NC=C2C(C)C)N=C1)(O)O |
Computed by PubChem (NCBI)