CAS 2225154-45-8 is the registry number for (2–hydroxy–4–(methyl–d3)pyrimidin–5–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-oxo-6-(trideuteriomethyl)-1H-pyrimidin-5-yl]boronic acid (CAS 2225154-45-8) is a chemical compound with the molecular formula C5H7BN2O3 and a molecular weight of 156.95 g/mol. IUPAC name: [2-oxo-6-(trideuteriomethyl)-1H-pyrimidin-5-yl]boronic acid. InChIKey: HTJUNTUGDRNCPL-FIBGUPNXSA-N.
| Molecular formula | C5H7BN2O3 |
|---|---|
| Molecular weight | 156.95 g/mol |
| IUPAC name | [2-oxo-6-(trideuteriomethyl)-1H-pyrimidin-5-yl]boronic acid |
| InChIKey | HTJUNTUGDRNCPL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C=NC(=O)N1)B(O)O |
Computed by PubChem (NCBI)