Products 2225169-50-4
CAS 2225169-50-4 is the registry number for (4–(piperazin–1–yl)–2–(trifluoromethyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
[4-piperazin-1-yl-2-(trifluoromethyl)phenyl]boronic acid (CAS 2225169-50-4) is a chemical compound with the molecular formula C11H14BF3N2O2 and a molecular weight of 274.05 g/mol. IUPAC name: [4-piperazin-1-yl-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: VXYAGFYXWMJNHJ-UHFFFAOYSA-N.
| Molecular formula | C11H14BF3N2O2 |
|---|---|
| Molecular weight | 274.05 g/mol |
| IUPAC name | [4-piperazin-1-yl-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | VXYAGFYXWMJNHJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2CCNCC2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)