CAS 2225177-56-8 is the registry number for 2–Trifluoromethyl–6–(piperidin–4–yl)pyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-piperidin-4-yl-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS 2225177-56-8) is a chemical compound with the molecular formula C11H14BF3N2O2 and a molecular weight of 274.05 g/mol. IUPAC name: [2-piperidin-4-yl-6-(trifluoromethyl)-4-pyridinyl]boronic acid. InChIKey: QIWNWLIVDWLLOV-UHFFFAOYSA-N.
| Molecular formula | C11H14BF3N2O2 |
|---|---|
| Molecular weight | 274.05 g/mol |
| IUPAC name | [2-piperidin-4-yl-6-(trifluoromethyl)-4-pyridinyl]boronic acid |
| InChIKey | QIWNWLIVDWLLOV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)C(F)(F)F)C2CCNCC2)(O)O |
Computed by PubChem (NCBI)