CAS 2225170-44-3 is the registry number for 5–Chloro–6–(pyridin–2–yl)pyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
(5-chloro-6-pyridin-2-yl-3-pyridinyl)boronic acid (CAS 2225170-44-3) is a chemical compound with the molecular formula C10H8BClN2O2 and a molecular weight of 234.45 g/mol. IUPAC name: (5-chloro-6-pyridin-2-yl-3-pyridinyl)boronic acid. InChIKey: OSZPROFIPARRRM-UHFFFAOYSA-N.
| Molecular formula | C10H8BClN2O2 |
|---|---|
| Molecular weight | 234.45 g/mol |
| IUPAC name | (5-chloro-6-pyridin-2-yl-3-pyridinyl)boronic acid |
| InChIKey | OSZPROFIPARRRM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)C2=CC=CC=N2)Cl)(O)O |
Computed by PubChem (NCBI)