CAS 2225175-90-4 is the registry number for (2–(4–chlorophenyl)pyrimidin–5–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[2-(4-chlorophenyl)pyrimidin-5-yl]boronic acid (CAS 2225175-90-4) is a chemical compound with the molecular formula C10H8BClN2O2 and a molecular weight of 234.45 g/mol. IUPAC name: [2-(4-chlorophenyl)pyrimidin-5-yl]boronic acid. InChIKey: APUFDJWDXZUCTA-UHFFFAOYSA-N.
| Molecular formula | C10H8BClN2O2 |
|---|---|
| Molecular weight | 234.45 g/mol |
| IUPAC name | [2-(4-chlorophenyl)pyrimidin-5-yl]boronic acid |
| InChIKey | APUFDJWDXZUCTA-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)C2=CC=C(C=C2)Cl)(O)O |
Computed by PubChem (NCBI)