CAS 2225171-91-3 is the registry number for 4–Chloro–2–methyl–5–cyclopropylphenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(4-chloro-5-cyclopropyl-2-methylphenyl)boronic acid (CAS 2225171-91-3) is a chemical compound with the molecular formula C10H12BClO2 and a molecular weight of 210.47 g/mol. IUPAC name: (4-chloro-5-cyclopropyl-2-methylphenyl)boronic acid. InChIKey: IKACWIVFNGIDFG-UHFFFAOYSA-N.
| Molecular formula | C10H12BClO2 |
|---|---|
| Molecular weight | 210.47 g/mol |
| IUPAC name | (4-chloro-5-cyclopropyl-2-methylphenyl)boronic acid |
| InChIKey | IKACWIVFNGIDFG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)Cl)C2CC2)(O)O |
Computed by PubChem (NCBI)