CAS 2225173-13-5 is the registry number for 2–Chloro–4–cyclopropyl–6–methylphenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(2-chloro-4-cyclopropyl-6-methylphenyl)boronic acid (CAS 2225173-13-5) is a chemical compound with the molecular formula C10H12BClO2 and a molecular weight of 210.47 g/mol. IUPAC name: (2-chloro-4-cyclopropyl-6-methylphenyl)boronic acid. InChIKey: BXXGXMAXNOFVFY-UHFFFAOYSA-N.
| Molecular formula | C10H12BClO2 |
|---|---|
| Molecular weight | 210.47 g/mol |
| IUPAC name | (2-chloro-4-cyclopropyl-6-methylphenyl)boronic acid |
| InChIKey | BXXGXMAXNOFVFY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)C2CC2)Cl)(O)O |
Computed by PubChem (NCBI)