CAS 2225172-18-7 is the registry number for 3,5–Bis(1H–pyrrol–1–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[3,5-di(pyrrol-1-yl)phenyl]boronic acid (CAS 2225172-18-7) is a chemical compound with the molecular formula C14H13BN2O2 and a molecular weight of 252.08 g/mol. IUPAC name: [3,5-di(pyrrol-1-yl)phenyl]boronic acid. InChIKey: UHNOVSTZXKUWBX-UHFFFAOYSA-N.
| Molecular formula | C14H13BN2O2 |
|---|---|
| Molecular weight | 252.08 g/mol |
| IUPAC name | [3,5-di(pyrrol-1-yl)phenyl]boronic acid |
| InChIKey | UHNOVSTZXKUWBX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N2C=CC=C2)N3C=CC=C3)(O)O |
Computed by PubChem (NCBI)