Products 2377608-29-0
CAS 2377608-29-0 appears in our catalog under these names: (4-{6-Methylimidazo[1,2-a]pyridin-2-yl}phenyl)boronic acid, 98%, (4-(6-Methylimidazo(1,2-a)pyridin-2-yl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[4-(6-methylimidazo[1,2-a]pyridin-2-yl)phenyl]boronic acid (CAS 2377608-29-0) is a chemical compound with the molecular formula C14H13BN2O2 and a molecular weight of 252.08 g/mol. IUPAC name: [4-(6-methylimidazo[1,2-a]pyridin-2-yl)phenyl]boronic acid. InChIKey: DJIJHEVZQXFNQS-UHFFFAOYSA-N.
| Molecular formula | C14H13BN2O2 |
|---|---|
| Molecular weight | 252.08 g/mol |
| IUPAC name | [4-(6-methylimidazo[1,2-a]pyridin-2-yl)phenyl]boronic acid |
| InChIKey | DJIJHEVZQXFNQS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CN3C=C(C=CC3=N2)C)(O)O |
Computed by PubChem (NCBI)