CAS 2225174-03-6 is the registry number for 2–Bromo–6–(3–furyl)pyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[2-bromo-6-(furan-3-yl)-4-pyridinyl]boronic acid (CAS 2225174-03-6) is a chemical compound with the molecular formula C9H7BBrNO3 and a molecular weight of 267.87 g/mol. IUPAC name: [2-bromo-6-(furan-3-yl)-4-pyridinyl]boronic acid. InChIKey: JUVKMCKBOWYYAG-UHFFFAOYSA-N.
| Molecular formula | C9H7BBrNO3 |
|---|---|
| Molecular weight | 267.87 g/mol |
| IUPAC name | [2-bromo-6-(furan-3-yl)-4-pyridinyl]boronic acid |
| InChIKey | JUVKMCKBOWYYAG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Br)C2=COC=C2)(O)O |
Computed by PubChem (NCBI)