CAS 2225176-10-1 is the registry number for 5–(4–Bromopyridin–2–yl)furan–2–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[5-(4-bromo-2-pyridinyl)furan-2-yl]boronic acid (CAS 2225176-10-1) is a chemical compound with the molecular formula C9H7BBrNO3 and a molecular weight of 267.87 g/mol. IUPAC name: [5-(4-bromo-2-pyridinyl)furan-2-yl]boronic acid. InChIKey: XGNSDVQYOILSCZ-UHFFFAOYSA-N.
| Molecular formula | C9H7BBrNO3 |
|---|---|
| Molecular weight | 267.87 g/mol |
| IUPAC name | [5-(4-bromo-2-pyridinyl)furan-2-yl]boronic acid |
| InChIKey | XGNSDVQYOILSCZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(O1)C2=NC=CC(=C2)Br)(O)O |
Computed by PubChem (NCBI)