CAS 2225175-28-8 is the registry number for 5–Chloro–6–(3–methoxyphenyl)pyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
[5-chloro-6-(3-methoxyphenyl)-3-pyridinyl]boronic acid (CAS 2225175-28-8) is a chemical compound with the molecular formula C12H11BClNO3 and a molecular weight of 263.48 g/mol. IUPAC name: [5-chloro-6-(3-methoxyphenyl)-3-pyridinyl]boronic acid. InChIKey: MHOCRSMYEXASEL-UHFFFAOYSA-N.
| Molecular formula | C12H11BClNO3 |
|---|---|
| Molecular weight | 263.48 g/mol |
| IUPAC name | [5-chloro-6-(3-methoxyphenyl)-3-pyridinyl]boronic acid |
| InChIKey | MHOCRSMYEXASEL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)C2=CC(=CC=C2)OC)Cl)(O)O |
Computed by PubChem (NCBI)