Products 850864-58-3

CAS 850864-58-3 is the registry number for 2-Benzyloxy-5-chloropyridine-3-boronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

(5-chloro-2-phenylmethoxy-3-pyridinyl)boronic acid (CAS 850864-58-3) is a chemical compound with the molecular formula C12H11BClNO3 and a molecular weight of 263.48 g/mol. IUPAC name: (5-chloro-2-phenylmethoxy-3-pyridinyl)boronic acid. InChIKey: WSTGGDQWIOLAIE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11BClNO3
Molecular weight263.48 g/mol
IUPAC name(5-chloro-2-phenylmethoxy-3-pyridinyl)boronic acid
InChIKeyWSTGGDQWIOLAIE-UHFFFAOYSA-N
SMILESB(C1=CC(=CN=C1OCC2=CC=CC=C2)Cl)(O)O

Computed by PubChem (NCBI)