CAS 2225175-58-4 is the registry number for (4–(ethyl–d5)pyrimidin–5–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[4-(1,1,2,2,2-pentadeuterioethyl)pyrimidin-5-yl]boronic acid (CAS 2225175-58-4) is a chemical compound with the molecular formula C6H9BN2O2 and a molecular weight of 156.99 g/mol. IUPAC name: [4-(1,1,2,2,2-pentadeuterioethyl)pyrimidin-5-yl]boronic acid. InChIKey: ZXUQJGARAXFYOB-ZBJDZAJPSA-N.
| Molecular formula | C6H9BN2O2 |
|---|---|
| Molecular weight | 156.99 g/mol |
| IUPAC name | [4-(1,1,2,2,2-pentadeuterioethyl)pyrimidin-5-yl]boronic acid |
| InChIKey | ZXUQJGARAXFYOB-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=NC=NC=C1B(O)O |
Computed by PubChem (NCBI)