CAS 2241877-10-9 is the registry number for (2,4–bis(methyl–d3)pyrimidin–5–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 1mg.
[2,4-bis(trideuteriomethyl)pyrimidin-5-yl]boronic acid (CAS 2241877-10-9) is a chemical compound with the molecular formula C6H9BN2O2 and a molecular weight of 158.00 g/mol. IUPAC name: [2,4-bis(trideuteriomethyl)pyrimidin-5-yl]boronic acid. InChIKey: YMFQYFJUILYFSC-WFGJKAKNSA-N.
| Molecular formula | C6H9BN2O2 |
|---|---|
| Molecular weight | 158.00 g/mol |
| IUPAC name | [2,4-bis(trideuteriomethyl)pyrimidin-5-yl]boronic acid |
| InChIKey | YMFQYFJUILYFSC-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC(=NC=C1B(O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)