CAS 2225176-41-8 is the registry number for 4–Fluoro–2–(thiazol–4–yl)pyridine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[4-fluoro-6-(1,3-thiazol-4-yl)-3-pyridinyl]boronic acid (CAS 2225176-41-8) is a chemical compound with the molecular formula C8H6BFN2O2S and a molecular weight of 224.02 g/mol. IUPAC name: [4-fluoro-6-(1,3-thiazol-4-yl)-3-pyridinyl]boronic acid. InChIKey: GUVFEBJYPQCTOC-UHFFFAOYSA-N.
| Molecular formula | C8H6BFN2O2S |
|---|---|
| Molecular weight | 224.02 g/mol |
| IUPAC name | [4-fluoro-6-(1,3-thiazol-4-yl)-3-pyridinyl]boronic acid |
| InChIKey | GUVFEBJYPQCTOC-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1F)C2=CSC=N2)(O)O |
Computed by PubChem (NCBI)