CAS 2225177-16-0 is the registry number for 2–Fluoro–6–(thiazol–4–yl)pyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[2-fluoro-6-(1,3-thiazol-4-yl)-3-pyridinyl]boronic acid (CAS 2225177-16-0) is a chemical compound with the molecular formula C8H6BFN2O2S and a molecular weight of 224.02 g/mol. IUPAC name: [2-fluoro-6-(1,3-thiazol-4-yl)-3-pyridinyl]boronic acid. InChIKey: NPFQKEHPUKBGSD-UHFFFAOYSA-N.
| Molecular formula | C8H6BFN2O2S |
|---|---|
| Molecular weight | 224.02 g/mol |
| IUPAC name | [2-fluoro-6-(1,3-thiazol-4-yl)-3-pyridinyl]boronic acid |
| InChIKey | NPFQKEHPUKBGSD-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)C2=CSC=N2)F)(O)O |
Computed by PubChem (NCBI)