CAS 2225176-63-4 is the registry number for 4–Chloro–3–methoxy–6–bromophenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(2-bromo-4-chloro-5-methoxyphenyl)boronic acid (CAS 2225176-63-4) is a chemical compound with the molecular formula C7H7BBrClO3 and a molecular weight of 265.30 g/mol. IUPAC name: (2-bromo-4-chloro-5-methoxyphenyl)boronic acid. InChIKey: JSHHWLFNBJAGCE-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrClO3 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2-bromo-4-chloro-5-methoxyphenyl)boronic acid |
| InChIKey | JSHHWLFNBJAGCE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Br)Cl)OC)(O)O |
Computed by PubChem (NCBI)