Products 2225176-89-4
CAS 2225176-89-4 is the registry number for 6–Bromo–5–trifluoromethylpyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[6-bromo-5-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 2225176-89-4) is a chemical compound with the molecular formula C6H4BBrF3NO2 and a molecular weight of 269.81 g/mol. IUPAC name: [6-bromo-5-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: QBFQUBLUXWZGDD-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF3NO2 |
|---|---|
| Molecular weight | 269.81 g/mol |
| IUPAC name | [6-bromo-5-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | QBFQUBLUXWZGDD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)Br)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)