Products 225916-39-2
CAS 225916-39-2 appears in our catalog under these names: 2-(4-Fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 97%, 4-FLUOROPHENYLBORONIC ACID NEOPENTYLGLYC, 4-Fluorophenylboronic acid, neopentyl ester, 97%. Offered by: Fluorochem, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
2-(4-fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 225916-39-2) is a chemical compound with the molecular formula C11H14BFO2 and a molecular weight of 208.04 g/mol. IUPAC name: 2-(4-fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: GWWSSPCPSWVJRZ-UHFFFAOYSA-N.
| Molecular formula | C11H14BFO2 |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | GWWSSPCPSWVJRZ-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)