CAS 2225181-54-2 is the registry number for (3–bromo–4–cyclopropylphenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
(3-bromo-4-cyclopropylphenyl)boronic acid (CAS 2225181-54-2) is a chemical compound with the molecular formula C9H10BBrO2 and a molecular weight of 240.89 g/mol. IUPAC name: (3-bromo-4-cyclopropylphenyl)boronic acid. InChIKey: JFQAGTFNPDZVFA-UHFFFAOYSA-N.
| Molecular formula | C9H10BBrO2 |
|---|---|
| Molecular weight | 240.89 g/mol |
| IUPAC name | (3-bromo-4-cyclopropylphenyl)boronic acid |
| InChIKey | JFQAGTFNPDZVFA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2CC2)Br)(O)O |
Computed by PubChem (NCBI)