CAS 488133-21-7 appears in our catalog under these names: 4-Bromomethylphenyl-1,3,2-dioxaborolane, 97%, 2-(4-(Bromomethyl)phenyl)-1,3,2-dioxaborolane, 97%, 4-Bromomethylphenyl-1,3,2-dioxaborolane. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g, 250mg.
2-[4-(bromomethyl)phenyl]-1,3,2-dioxaborolane (CAS 488133-21-7) is a chemical compound with the molecular formula C9H10BBrO2 and a molecular weight of 240.89 g/mol. IUPAC name: 2-[4-(bromomethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: GNLXZUWZSBFRHM-UHFFFAOYSA-N.
| Molecular formula | C9H10BBrO2 |
|---|---|
| Molecular weight | 240.89 g/mol |
| IUPAC name | 2-[4-(bromomethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | GNLXZUWZSBFRHM-UHFFFAOYSA-N |
| SMILES | B1(OCCO1)C2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)