Products 22253-59-4
CAS 22253-59-4 appears in our catalog under these names: 4-(Trifluoromethyl)pyridine 1-oxide, 95%, 4-Trifluoromethylpyridine N-oxide, 95-<97%, 4-(Trifluoromethyl)pyridine 1-oxide, 98%(LC-MS),RG, 98%(LC-MS),RG, 4-(Trifluoromethyl)pyridine 1-oxide, 98%(LC-MS),RG. Offered by: Combi-blocks, Hoffman Fine Chemicals, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 25g, 50g, 100g, 5g, 100mg.
1-oxido-4-(trifluoromethyl)pyridin-1-ium (CAS 22253-59-4) is a chemical compound with the molecular formula C6H4F3NO and a molecular weight of 163.10 g/mol. IUPAC name: 1-oxido-4-(trifluoromethyl)pyridin-1-ium. InChIKey: WDUUZHQOZHEULL-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO |
|---|---|
| Molecular weight | 163.10 g/mol |
| IUPAC name | 1-oxido-4-(trifluoromethyl)pyridin-1-ium |
| InChIKey | WDUUZHQOZHEULL-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC=C1C(F)(F)F)[O-] |
Computed by PubChem (NCBI)