cas: 22253-59-4 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)pyridine 1-oxide, 98%(LC-MS),RG, 98%(LC-MS),RG (CAS 22253-59-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118P20-100mg |
| cas | 22253-59-4 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 640.40 Pln | |
| Chemat | 5g | 1883.60 Pln | |
| Chemat | 25g | 8982.80 Pln |
| purity | 98%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
1-oxido-4-(trifluoromethyl)pyridin-1-ium (CAS 22253-59-4) is a chemical compound with the molecular formula C6H4F3NO and a molecular weight of 163.10 g/mol. IUPAC name: 1-oxido-4-(trifluoromethyl)pyridin-1-ium. InChIKey: WDUUZHQOZHEULL-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO |
|---|---|
| Molecular weight | 163.10 g/mol |
| IUPAC name | 1-oxido-4-(trifluoromethyl)pyridin-1-ium |
| InChIKey | WDUUZHQOZHEULL-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC=C1C(F)(F)F)[O-] |
Computed by PubChem (NCBI)